CAS 86106-93-6 is the registry number for 5-Bromo-1-(2-chloroethyl)indoline-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-1-(2-chloroethyl)indole-2,3-dione (CAS 86106-93-6) is a chemical compound with the molecular formula C10H7BrClNO2 and a molecular weight of 288.52 g/mol. IUPAC name: 5-bromo-1-(2-chloroethyl)indole-2,3-dione. InChIKey: WHEUPDAIWDZKHH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO2 |
|---|---|
| Molecular weight | 288.52 g/mol |
| IUPAC name | 5-bromo-1-(2-chloroethyl)indole-2,3-dione |
| InChIKey | WHEUPDAIWDZKHH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=O)N2CCCl |
Computed by PubChem (NCBI)