Products 1253787-55-1
CAS 1253787-55-1 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)-2,2-difluoroethan-1-one, ≥95%, ≥95%, 1-(3,5-Dichlorophenyl)-2,2-difluoroethanone, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1-(3,5-dichlorophenyl)-2,2-difluoroethanone (CAS 1253787-55-1) is a chemical compound with the molecular formula C8H4Cl2F2O and a molecular weight of 225.02 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,2-difluoroethanone. InChIKey: GIFAXPJNNAPIQA-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O |
|---|---|
| Molecular weight | 225.02 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,2-difluoroethanone |
| InChIKey | GIFAXPJNNAPIQA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=O)C(F)F |
Computed by PubChem (NCBI)