CAS 1271477-78-1 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2,2-difluoroethanone, 97%, 1-(3,4-Dichlorophenyl)-2,2-difluoroethanone, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
1-(3,4-dichlorophenyl)-2,2-difluoroethanone (CAS 1271477-78-1) is a chemical compound with the molecular formula C8H4Cl2F2O and a molecular weight of 225.02 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2,2-difluoroethanone. InChIKey: KOROPRSEGSHUTP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O |
|---|---|
| Molecular weight | 225.02 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2,2-difluoroethanone |
| InChIKey | KOROPRSEGSHUTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)F)Cl)Cl |
Computed by PubChem (NCBI)