Products 2299889-69-1
CAS 2299889-69-1 is the registry number for 1-(3,5-dichloro-2-fluorophenyl)-2-fluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3,5-dichloro-2-fluorophenyl)-2-fluoroethanone (CAS 2299889-69-1) is a chemical compound with the molecular formula C8H4Cl2F2O and a molecular weight of 225.02 g/mol. IUPAC name: 1-(3,5-dichloro-2-fluorophenyl)-2-fluoroethanone. InChIKey: ZHXGJMWWNQBEAA-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O |
|---|---|
| Molecular weight | 225.02 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-fluorophenyl)-2-fluoroethanone |
| InChIKey | ZHXGJMWWNQBEAA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)CF)F)Cl)Cl |
Computed by PubChem (NCBI)