Products 1253789-07-9
CAS 1253789-07-9 appears in our catalog under these names: 1-tert-Butyl 3-methyl 1,4-diazepane-1,3-dicarboxylate, 95%, Hexahydro-1H-1,4-diazepine-1,3-dicarboxylic Acid 1-(1,1-Dimethylethyl) 3-Methyl Ester, 1-tert-Butyl 3-methyl 1,4-diazepane-1,3-dicarboxylate, 95+%, 1-tert-butyl 3-methyl 1,4-diazepane-1,3-dicarboxylate, 1-Tert-butyl 3-methyl 1,4-diazepane-1,3-dicarboxylate, >95%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g, 100mg.
1-O-tert-butyl 3-O-methyl 1,4-diazepane-1,3-dicarboxylate (CAS 1253789-07-9) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 1,4-diazepane-1,3-dicarboxylate. InChIKey: YSYMUPJCVXOHAH-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 1,4-diazepane-1,3-dicarboxylate |
| InChIKey | YSYMUPJCVXOHAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCNC(C1)C(=O)OC |
Computed by PubChem (NCBI)