CAS 1253789-97-7 appears in our catalog under these names: 1-Bromo-4-fluoro-6,7,8,9-tetrahydro-5h-benzo[7]annulen-5-one, 95%, 1-Bromo-4-fluoro-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1-bromo-4-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CAS 1253789-97-7) is a chemical compound with the molecular formula C11H10BrFO and a molecular weight of 257.10 g/mol. IUPAC name: 1-bromo-4-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. InChIKey: IGPLVEFINYOCIR-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO |
|---|---|
| Molecular weight | 257.10 g/mol |
| IUPAC name | 1-bromo-4-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| InChIKey | IGPLVEFINYOCIR-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=C(C=CC(=C2C1)Br)F |
Computed by PubChem (NCBI)