CAS 1415003-42-7 is the registry number for 3-Bromo-2-fluoro-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CAS 1415003-42-7) is a chemical compound with the molecular formula C11H10BrFO and a molecular weight of 257.10 g/mol. IUPAC name: 3-bromo-2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. InChIKey: XRSLFFCDJKLXEC-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO |
|---|---|
| Molecular weight | 257.10 g/mol |
| IUPAC name | 3-bromo-2-fluoro-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| InChIKey | XRSLFFCDJKLXEC-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=CC(=C(C=C2C1)F)Br |
Computed by PubChem (NCBI)