Products 1644239-93-9
CAS 1644239-93-9 is the registry number for 6-(difluoromethyl)-5-methylpyridine-3-carboxamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-bromo-4-fluoro-3,3-dimethyl-2H-inden-1-one (CAS 1644239-93-9) is a chemical compound with the molecular formula C11H10BrFO and a molecular weight of 257.10 g/mol. IUPAC name: 6-bromo-4-fluoro-3,3-dimethyl-2H-inden-1-one. InChIKey: JOIAHNQTVXFKSR-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO |
|---|---|
| Molecular weight | 257.10 g/mol |
| IUPAC name | 6-bromo-4-fluoro-3,3-dimethyl-2H-inden-1-one |
| InChIKey | JOIAHNQTVXFKSR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C(=CC(=C2)Br)F)C |
Computed by PubChem (NCBI)