Products 1253790-25-8

CAS 1253790-25-8 is the registry number for Lacosamide Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]carbamate (CAS 1253790-25-8) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]carbamate. InChIKey: ZEWWJSJMNBJIKR-ZDUSSCGKSA-N.

Identity
Molecular formulaC16H24N2O4
Molecular weight308.37 g/mol
IUPAC nametert-butyl N-[(2S)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]carbamate
InChIKeyZEWWJSJMNBJIKR-ZDUSSCGKSA-N
SMILESCC(C)(C)OC(=O)N[C@@H](COC)C(=O)NCC1=CC=CC=C1

Computed by PubChem (NCBI)