Products 1253929-39-3
CAS 1253929-39-3 is the registry number for 1-(4-Bromo-3-indolyl)-2,2,2-trifluoroethanone, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-(4-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone (CAS 1253929-39-3) is a chemical compound with the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. IUPAC name: 1-(4-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone. InChIKey: AKUDWWYAOQAMRE-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3NO |
|---|---|
| Molecular weight | 292.05 g/mol |
| IUPAC name | 1-(4-bromo-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | AKUDWWYAOQAMRE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)