CAS 1254119-78-2 appears in our catalog under these names: 3,3,5,5-Tetramethylcyclohexane-1-carboxylic acid, 3,3,5,5-Tetramethylcyclohexane-1-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
3,3,5,5-tetramethylcyclohexane-1-carboxylic acid (CAS 1254119-78-2) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: 3,3,5,5-tetramethylcyclohexane-1-carboxylic acid. InChIKey: VQGYCTRDKSTGJU-UHFFFAOYSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | 3,3,5,5-tetramethylcyclohexane-1-carboxylic acid |
| InChIKey | VQGYCTRDKSTGJU-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(C1)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)