CAS 1254321-23-7 is the registry number for rac Deprenyl-d8. Offered by: TRC. Available pack sizes: 25mg.
1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine (CAS 1254321-23-7) is a chemical compound with the molecular formula C13H17N and a molecular weight of 195.33 g/mol. IUPAC name: 1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine. InChIKey: MEZLKOACVSPNER-HEWZHJHFSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 195.33 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine |
| InChIKey | MEZLKOACVSPNER-HEWZHJHFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(C)N(CC#C)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)