CAS 1254365-79-1 appears in our catalog under these names: Methyl 2-(3,4-dichlorophenyl)-3-hydroxypropanoate, 95%, Methyl 2-(3,4-dichlorophenyl)-3-hydroxypropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Methyl 2-(3,4-dichlorophenyl)-3-hydroxypropanoate (CAS 1254365-79-1) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: methyl 2-(3,4-dichlorophenyl)-3-hydroxypropanoate. InChIKey: VWPJQLPZFIYXCG-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | methyl 2-(3,4-dichlorophenyl)-3-hydroxypropanoate |
| InChIKey | VWPJQLPZFIYXCG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CO)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)