CAS 125441-05-6 appears in our catalog under these names: H-Tyr-oall p-tosylate, 95%, (S)-Allyl 2-amino-3-(4-hydroxyphenyl)propanoate 4-methylbenzenesulfonate, 95+%, (S)-Allyl 2-amino-3-(4-hydroxyphenyl)propanoate 4-methylbenzenesulfonate, ≥98.0%, ≥98.0%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 25g, 100g.
4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (CAS 125441-05-6) is a chemical compound with the molecular formula C19H23NO6S and a molecular weight of 393.5 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate. InChIKey: MPNOOYSRGYNTIE-MERQFXBCSA-N.
| Molecular formula | C19H23NO6S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| InChIKey | MPNOOYSRGYNTIE-MERQFXBCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CCOC(=O)[C@H](CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)