CAS 144208-62-8 appears in our catalog under these names: 2-(2-(((Benzyloxy)Carbonyl)Amino)Ethoxy)Ethyl 4-Methylbenzenesulfonate, 97%, 97%, OTs-PEG1-NHCbz, 97.0%, 2-(2-(((Benzyloxy)carbonyl)amino)ethoxy)ethyl 4-methylbenzenesulfonate, 97%, Toluene-4-sulfonic acid 2-(2-benzyloxycarbonylamino-ethoxy)-ethyl ester, 97%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g, 500 mg, 5 g, 1 g.
2-[2-(phenylmethoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate (CAS 144208-62-8) is a chemical compound with the molecular formula C19H23NO6S and a molecular weight of 393.5 g/mol. IUPAC name: 2-[2-(phenylmethoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: BDNVZFIGDYNZFH-UHFFFAOYSA-N.
| Molecular formula | C19H23NO6S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 2-[2-(phenylmethoxycarbonylamino)ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | BDNVZFIGDYNZFH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)