CAS 88501-00-2 is the registry number for (2S)-Benzyl 4-hydroxypyrrolidine-2-carboxylate 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 4-hydroxypyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid (CAS 88501-00-2) is a chemical compound with the molecular formula C19H23NO6S and a molecular weight of 393.5 g/mol. IUPAC name: benzyl 4-hydroxypyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid. InChIKey: YHFQLNADHUYVAF-UHFFFAOYSA-N.
| Molecular formula | C19H23NO6S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | benzyl 4-hydroxypyrrolidine-2-carboxylate;4-methylbenzenesulfonic acid |
| InChIKey | YHFQLNADHUYVAF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C(CNC1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)