Products 1255099-33-2
CAS 1255099-33-2 appears in our catalog under these names: 6,7-Dihydro-5h-[1,3]dioxolo[4,5-f]isoindole hydrochloride, 95%, 6,7-Dihydro-5H-(1,3)dioxolo(4,5-f)isoindole hydrochloride, 95%, 6，7–Dihydro–5H–(1，3)dioxolo(4，5–f)isoindole hydrochloride, 6,7-DIHYDRO-5H-[1,3]DIOXO[4,5-F]ISOINDOLE HYDROCHLORIDE, 95%, 6,7-Dihydro-5h-[1,3]dioxolo[4,5-f]isoindole, HCl, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
6,7-dihydro-5H-[1,3]dioxolo[4,5-f]isoindole;hydrochloride (CAS 1255099-33-2) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 6,7-dihydro-5H-[1,3]dioxolo[4,5-f]isoindole;hydrochloride. InChIKey: JYKBTERGPCWRCK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 6,7-dihydro-5H-[1,3]dioxolo[4,5-f]isoindole;hydrochloride |
| InChIKey | JYKBTERGPCWRCK-UHFFFAOYSA-N |
| SMILES | C1C2=CC3=C(C=C2CN1)OCO3.Cl |
Computed by PubChem (NCBI)