Products 1255666-59-1
CAS 1255666-59-1 appears in our catalog under these names: 3,3-DIFLUORO-1-BOC-AZETIDINE, 98+%, tert-Butyl 3,3-difluoroazetidine-1-carboxylate, 98+%, 98+%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g.
Tert-butyl 3,3-difluoroazetidine-1-carboxylate (CAS 1255666-59-1) is a chemical compound with the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. IUPAC name: tert-butyl 3,3-difluoroazetidine-1-carboxylate. InChIKey: GJXFELMSTZXKLU-UHFFFAOYSA-N.
| Molecular formula | C8H13F2NO2 |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | tert-butyl 3,3-difluoroazetidine-1-carboxylate |
| InChIKey | GJXFELMSTZXKLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(F)F |
Computed by PubChem (NCBI)