CAS 2761951-94-2 is the registry number for Methyl (R)-2-(5,5-difluoropiperidin-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(3R)-5,5-difluoropiperidin-3-yl]acetate (CAS 2761951-94-2) is a chemical compound with the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. IUPAC name: methyl 2-[(3R)-5,5-difluoropiperidin-3-yl]acetate. InChIKey: SUGXRJHYTSXVGY-ZCFIWIBFSA-N.
| Molecular formula | C8H13F2NO2 |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | methyl 2-[(3R)-5,5-difluoropiperidin-3-yl]acetate |
| InChIKey | SUGXRJHYTSXVGY-ZCFIWIBFSA-N |
| SMILES | COC(=O)C[C@@H]1CC(CNC1)(F)F |
Computed by PubChem (NCBI)