CAS 1408278-46-5 is the registry number for Methyl (S)-4,4-difluoro-3,3-dimethylpyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-4,4-difluoro-3,3-dimethylpyrrolidine-2-carboxylate (CAS 1408278-46-5) is a chemical compound with the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. IUPAC name: methyl (2S)-4,4-difluoro-3,3-dimethylpyrrolidine-2-carboxylate. InChIKey: GRKLJERCYDYYIA-RXMQYKEDSA-N.
| Molecular formula | C8H13F2NO2 |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoro-3,3-dimethylpyrrolidine-2-carboxylate |
| InChIKey | GRKLJERCYDYYIA-RXMQYKEDSA-N |
| SMILES | CC1([C@H](NCC1(F)F)C(=O)OC)C |
Computed by PubChem (NCBI)