CAS 1781115-34-1 is the registry number for 1-[(tert-butoxy)carbonyl]-5,5-difluoroazepane-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-4-carboxylic acid (CAS 1781115-34-1) is a chemical compound with the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. IUPAC name: 5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-4-carboxylic acid. InChIKey: RYYCZDKOGKXZIA-UHFFFAOYSA-N.
| Molecular formula | C12H19F2NO4 |
|---|---|
| Molecular weight | 279.28 g/mol |
| IUPAC name | 5,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-4-carboxylic acid |
| InChIKey | RYYCZDKOGKXZIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CC1)(F)F)C(=O)O |
Computed by PubChem (NCBI)