CAS 1255713-68-8 is the registry number for 5-Bromo-6-fluoro-3-methylbenzo(d)oxazol-2(3H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
5-bromo-6-fluoro-3-methyl-1,3-benzoxazol-2-one (CAS 1255713-68-8) is a chemical compound with the molecular formula C8H5BrFNO2 and a molecular weight of 246.03 g/mol. IUPAC name: 5-bromo-6-fluoro-3-methyl-1,3-benzoxazol-2-one. InChIKey: XYYJPHBUMGDAAK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO2 |
|---|---|
| Molecular weight | 246.03 g/mol |
| IUPAC name | 5-bromo-6-fluoro-3-methyl-1,3-benzoxazol-2-one |
| InChIKey | XYYJPHBUMGDAAK-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2OC1=O)F)Br |
Computed by PubChem (NCBI)