CAS 1260829-35-3 is the registry number for 7-Bromo-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
7-bromo-6-fluoro-4H-1,4-benzoxazin-3-one (CAS 1260829-35-3) is a chemical compound with the molecular formula C8H5BrFNO2 and a molecular weight of 246.03 g/mol. IUPAC name: 7-bromo-6-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: NZRPDUBLDNECDR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO2 |
|---|---|
| Molecular weight | 246.03 g/mol |
| IUPAC name | 7-bromo-6-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | NZRPDUBLDNECDR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)Br)F |
Computed by PubChem (NCBI)