CAS 355423-58-4 appears in our catalog under these names: 6-Bromo-7-fluoro-2,4-dihydro-1,4-benzoxazin-3-one, 95%, 6-Bromo-7-fluoro-2,4-dihydro-1,4-benzoxazin-3-one, 96% , 6-Bromo-7-fluoro-2,4-dihydro-1,4-benzoxazin-3-one, 6-Bromo-7-fluoro-2,4-dihydro-1,4-benzoxazin-3-one, 98%, 98%, 6-BROMO-7-FLUORO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g.
6-bromo-7-fluoro-4H-1,4-benzoxazin-3-one (CAS 355423-58-4) is a chemical compound with the molecular formula C8H5BrFNO2 and a molecular weight of 246.03 g/mol. IUPAC name: 6-bromo-7-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: AVHJMSMGASUDIT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO2 |
|---|---|
| Molecular weight | 246.03 g/mol |
| IUPAC name | 6-bromo-7-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | AVHJMSMGASUDIT-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)F)Br |
Computed by PubChem (NCBI)