CAS 1255717-19-1 appears in our catalog under these names: N1-(3-Aminophenyl)-n2,n2-dimethylglycinamide dihydrochloride, 95%, N~1~-(3-aminophenyl)-N~2~,N~2~-dimethylglycinamide dihydrochloride, 97%, N-(3-Aminophenyl)-2-(dimethylamino)acetamide dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g, 100mg, 250mg.
N-(3-aminophenyl)-2-(dimethylamino)acetamide;dihydrochloride (CAS 1255717-19-1) is a chemical compound with the molecular formula C10H17Cl2N3O and a molecular weight of 266.16 g/mol. IUPAC name: N-(3-aminophenyl)-2-(dimethylamino)acetamide;dihydrochloride. InChIKey: NLHIOQCZZQWWHI-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3O |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | N-(3-aminophenyl)-2-(dimethylamino)acetamide;dihydrochloride |
| InChIKey | NLHIOQCZZQWWHI-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)NC1=CC=CC(=C1)N.Cl.Cl |
Computed by PubChem (NCBI)