CAS 2044713-07-5 is the registry number for 2-{(4-(Aminomethyl)phenyl)(methyl)amino}acetamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4-(aminomethyl)-N-methylanilino]acetamide;dihydrochloride (CAS 2044713-07-5) is a chemical compound with the molecular formula C10H17Cl2N3O and a molecular weight of 266.16 g/mol. IUPAC name: 2-[4-(aminomethyl)-N-methylanilino]acetamide;dihydrochloride. InChIKey: PLCBZUFKXUSEDY-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3O |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | 2-[4-(aminomethyl)-N-methylanilino]acetamide;dihydrochloride |
| InChIKey | PLCBZUFKXUSEDY-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)N)C1=CC=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)