CAS 2137143-73-6 is the registry number for 2-(rac-(1R,4R)-4-Aminocyclohexyl)pyrimidin-4-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-aminocyclohexyl)-1H-pyrimidin-6-one;dihydrochloride (CAS 2137143-73-6) is a chemical compound with the molecular formula C10H17Cl2N3O and a molecular weight of 266.16 g/mol. IUPAC name: 2-(4-aminocyclohexyl)-1H-pyrimidin-6-one;dihydrochloride. InChIKey: QSPNIUGEJXYXGW-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3O |
|---|---|
| Molecular weight | 266.16 g/mol |
| IUPAC name | 2-(4-aminocyclohexyl)-1H-pyrimidin-6-one;dihydrochloride |
| InChIKey | QSPNIUGEJXYXGW-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=NC=CC(=O)N2)N.Cl.Cl |
Computed by PubChem (NCBI)