CAS 1255717-94-2 appears in our catalog under these names: ([5-(2-Furyl)-3-isoxazolyl]methyl)amine hydrochloride, 95%, (5-(Fur-2-yl)isoxazol-3-yl)methylamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
[5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine;hydrochloride (CAS 1255717-94-2) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: [5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine;hydrochloride. InChIKey: GCLDRGQJQVUGHB-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methanamine;hydrochloride |
| InChIKey | GCLDRGQJQVUGHB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NO2)CN.Cl |
Computed by PubChem (NCBI)