Products 1255718-05-8

CAS 1255718-05-8 is the registry number for (3-Methyl-5-oxo-4,5-dihydro-1h-pyrazol-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-methyl-5-oxo-4H-pyrazol-1-yl)acetic acid;hydrochloride (CAS 1255718-05-8) is a chemical compound with the molecular formula C6H9ClN2O3 and a molecular weight of 192.60 g/mol. IUPAC name: 2-(3-methyl-5-oxo-4H-pyrazol-1-yl)acetic acid;hydrochloride. InChIKey: AJJYJOMPYGWRFD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O3
Molecular weight192.60 g/mol
IUPAC name2-(3-methyl-5-oxo-4H-pyrazol-1-yl)acetic acid;hydrochloride
InChIKeyAJJYJOMPYGWRFD-UHFFFAOYSA-N
SMILESCC1=NN(C(=O)C1)CC(=O)O.Cl

Computed by PubChem (NCBI)