Products 2375269-15-9

CAS 2375269-15-9 is the registry number for 1-Methoxy-4-methyl-1H-imidazole-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-methoxy-5-methylimidazole-4-carboxylic acid;hydrochloride (CAS 2375269-15-9) is a chemical compound with the molecular formula C6H9ClN2O3 and a molecular weight of 192.60 g/mol. IUPAC name: 3-methoxy-5-methylimidazole-4-carboxylic acid;hydrochloride. InChIKey: YDTJPZXZQDSRPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O3
Molecular weight192.60 g/mol
IUPAC name3-methoxy-5-methylimidazole-4-carboxylic acid;hydrochloride
InChIKeyYDTJPZXZQDSRPZ-UHFFFAOYSA-N
SMILESCC1=C(N(C=N1)OC)C(=O)O.Cl

Computed by PubChem (NCBI)