Products 2703775-07-7

CAS 2703775-07-7 is the registry number for 5-(2-Aminoethyl)isoxazole-3-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

5-(2-aminoethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride (CAS 2703775-07-7) is a chemical compound with the molecular formula C6H9ClN2O3 and a molecular weight of 192.60 g/mol. IUPAC name: 5-(2-aminoethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride. InChIKey: DMGUUDRYLDTOKK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O3
Molecular weight192.60 g/mol
IUPAC name5-(2-aminoethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride
InChIKeyDMGUUDRYLDTOKK-UHFFFAOYSA-N
SMILESC1=C(ON=C1C(=O)O)CCN.Cl

Computed by PubChem (NCBI)