Products 1255718-13-8

CAS 1255718-13-8 is the registry number for 3-(1H-Pyrazol-1-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-pyrazol-1-ylpropanoic acid;hydrochloride (CAS 1255718-13-8) is a chemical compound with the molecular formula C6H9ClN2O2 and a molecular weight of 176.60 g/mol. IUPAC name: 3-pyrazol-1-ylpropanoic acid;hydrochloride. InChIKey: YJNKXIAOMFBRCU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O2
Molecular weight176.60 g/mol
IUPAC name3-pyrazol-1-ylpropanoic acid;hydrochloride
InChIKeyYJNKXIAOMFBRCU-UHFFFAOYSA-N
SMILESC1=CN(N=C1)CCC(=O)O.Cl

Computed by PubChem (NCBI)