Products 30163-87-2

CAS 30163-87-2 appears in our catalog under these names: 2-(2-methyl-1H-imidazol-1-yl)acetic acid hydrochloride, 2-(2-Methyl-1h-imidazol-1-yl)acetic acid hydrochloride, 95%, 2-(2-Methyl-1H-imidazol-1-yl)acetic acid hydrochloride, 98%, 2-(2-Methyl-1h-imidazol-1-yl)acetic acid hydrochloride, 98%, 98%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

2-(2-methylimidazol-1-yl)acetic acid;hydrochloride (CAS 30163-87-2) is a chemical compound with the molecular formula C6H9ClN2O2 and a molecular weight of 176.60 g/mol. IUPAC name: 2-(2-methylimidazol-1-yl)acetic acid;hydrochloride. InChIKey: CKZLSFDSQQKOSP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O2
Molecular weight176.60 g/mol
IUPAC name2-(2-methylimidazol-1-yl)acetic acid;hydrochloride
InChIKeyCKZLSFDSQQKOSP-UHFFFAOYSA-N
SMILESCC1=NC=CN1CC(=O)O.Cl

Computed by PubChem (NCBI)