Products 2243503-52-6

CAS 2243503-52-6 is the registry number for Methyl 5-methyl-1h-pyrazole-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-methyl-1H-pyrazole-3-carboxylate;hydrochloride (CAS 2243503-52-6) is a chemical compound with the molecular formula C6H9ClN2O2 and a molecular weight of 176.60 g/mol. IUPAC name: methyl 5-methyl-1H-pyrazole-3-carboxylate;hydrochloride. InChIKey: RBMMEVKUSVPULF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClN2O2
Molecular weight176.60 g/mol
IUPAC namemethyl 5-methyl-1H-pyrazole-3-carboxylate;hydrochloride
InChIKeyRBMMEVKUSVPULF-UHFFFAOYSA-N
SMILESCC1=CC(=NN1)C(=O)OC.Cl

Computed by PubChem (NCBI)