Products 1965314-57-1

CAS 1965314-57-1 is the registry number for (3R)-4-Methyl-3-morpholinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3R)-4-methylmorpholine-3-carboxylic acid;hydrochloride (CAS 1965314-57-1) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (3R)-4-methylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: NFUYTVFVCSMTQK-NUBCRITNSA-N.

Identity
Molecular formulaC6H12ClNO3
Molecular weight181.62 g/mol
IUPAC name(3R)-4-methylmorpholine-3-carboxylic acid;hydrochloride
InChIKeyNFUYTVFVCSMTQK-NUBCRITNSA-N
SMILESCN1CCOC[C@@H]1C(=O)O.Cl

Computed by PubChem (NCBI)