CAS 1255784-16-7 is the registry number for 3-(3-Chlorophenyl)thieno[3,2-d]pyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(3-chlorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 1255784-16-7) is a chemical compound with the molecular formula C12H7ClN2O2S and a molecular weight of 278.71 g/mol. IUPAC name: 3-(3-chlorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: YBORZOIYAUOICC-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O2S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | YBORZOIYAUOICC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=O)C3=C(C=CS3)NC2=O |
Computed by PubChem (NCBI)