CAS 912770-34-4 is the registry number for 6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid (CAS 912770-34-4) is a chemical compound with the molecular formula C12H7ClN2O2S and a molecular weight of 278.71 g/mol. IUPAC name: 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid. InChIKey: SIZNLUSBLMONHI-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O2S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid |
| InChIKey | SIZNLUSBLMONHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C(=CSC3=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)