CAS 886497-12-7 appears in our catalog under these names: 2-(3-Chlorothiophen-2-yl)-1H-benzo(d)imidazole-5-carboxylic acid, 97%, 2-(3-Chloro-thiophen-2-yl)-1H-benzoimidazole-5-carboxylic acid. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid (CAS 886497-12-7) is a chemical compound with the molecular formula C12H7ClN2O2S and a molecular weight of 278.71 g/mol. IUPAC name: 2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid. InChIKey: IDCAWLUVNIVRIO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O2S |
|---|---|
| Molecular weight | 278.71 g/mol |
| IUPAC name | 2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid |
| InChIKey | IDCAWLUVNIVRIO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)C3=C(C=CS3)Cl |
Computed by PubChem (NCBI)