Products 1255785-90-0
CAS 1255785-90-0 is the registry number for Methyl 4-amino-2-(dimethylamino)-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 4-amino-2-(dimethylamino)-1,3-thiazole-5-carboxylate (CAS 1255785-90-0) is a chemical compound with the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. IUPAC name: methyl 4-amino-2-(dimethylamino)-1,3-thiazole-5-carboxylate. InChIKey: CVWZNAFMOKXWNX-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | methyl 4-amino-2-(dimethylamino)-1,3-thiazole-5-carboxylate |
| InChIKey | CVWZNAFMOKXWNX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(S1)C(=O)OC)N |
Computed by PubChem (NCBI)