CAS 1255788-78-3 is the registry number for 2-(4-Chlorophenyl)pyrazolo[1,5-a]pyrazin-4(5h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-(4-chlorophenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1255788-78-3) is a chemical compound with the molecular formula C12H8ClN3O and a molecular weight of 245.66 g/mol. IUPAC name: 2-(4-chlorophenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: FXAIWBIJODBLIB-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | FXAIWBIJODBLIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN3C=CNC(=O)C3=C2)Cl |
Computed by PubChem (NCBI)