Products 320419-78-1
CAS 320419-78-1 is the registry number for 1-(3-chlorophenyl)-1,2-dihydro-3h-pyrazolo[3,4-b]pyridin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(3-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-3-one (CAS 320419-78-1) is a chemical compound with the molecular formula C12H8ClN3O and a molecular weight of 245.66 g/mol. IUPAC name: 1-(3-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-3-one. InChIKey: YGKIIOPVSTWANY-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2H-pyrazolo[3,4-b]pyridin-3-one |
| InChIKey | YGKIIOPVSTWANY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C3=C(C=CC=N3)C(=O)N2 |
Computed by PubChem (NCBI)