CAS 938465-52-2 appears in our catalog under these names: 1-Chloro-5H-pyrido(4,3-b)indole-4-carboxamide, 97%, 1–Chloro–5H–pyrido(4，3–b)indole–4–carboxamide. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide (CAS 938465-52-2) is a chemical compound with the molecular formula C12H8ClN3O and a molecular weight of 245.66 g/mol. IUPAC name: 1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide. InChIKey: VQNXPJGYVJPVIX-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3O |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide |
| InChIKey | VQNXPJGYVJPVIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CN=C3Cl)C(=O)N |
Computed by PubChem (NCBI)