CAS 1256097-94-5 appears in our catalog under these names: 2-Amino-4-cyclopropyl-1,3-thiazole-5-carboxylic acid, 95%, 2-Amino-4-cyclopropylthiazole-5-carboxylic acid, 95%, 95%, 2-Amino-4-cyclopropylthiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylic acid (CAS 1256097-94-5) is a chemical compound with the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. IUPAC name: 2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylic acid. InChIKey: UPPUXTADODDRDS-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S |
|---|---|
| Molecular weight | 184.22 g/mol |
| IUPAC name | 2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | UPPUXTADODDRDS-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(SC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)