CAS 87466-56-6 appears in our catalog under these names: 7,8-Dihydro-6h-thiopyrano[3,2-d]pyrimidine-2,4-diol, 95%, 7,8-Dihydro-1H-thiopyrano(3,2-d)pyrimidine-2,4(3H,6H)-dione, 95+%, 7,8–Dihydro–1H–thiopyrano(3,2–d)pyrimidine–2,4(3H,6H)–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1,6,7,8-tetrahydrothiopyrano[3,2-d]pyrimidine-2,4-dione (CAS 87466-56-6) is a chemical compound with the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. IUPAC name: 1,6,7,8-tetrahydrothiopyrano[3,2-d]pyrimidine-2,4-dione. InChIKey: MAFSFIYFBLFHAZ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S |
|---|---|
| Molecular weight | 184.22 g/mol |
| IUPAC name | 1,6,7,8-tetrahydrothiopyrano[3,2-d]pyrimidine-2,4-dione |
| InChIKey | MAFSFIYFBLFHAZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC(=O)N2)SC1 |
Computed by PubChem (NCBI)