CAS 23153-09-5 appears in our catalog under these names: 4-(Methylsulfanyl)-2-nitroaniline, 98%, 4–(Methylsulfanyl)–2–nitroaniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
4-methylsulfanyl-2-nitroaniline (CAS 23153-09-5) is a chemical compound with the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. IUPAC name: 4-methylsulfanyl-2-nitroaniline. InChIKey: LWFOZCFJVOGQAM-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S |
|---|---|
| Molecular weight | 184.22 g/mol |
| IUPAC name | 4-methylsulfanyl-2-nitroaniline |
| InChIKey | LWFOZCFJVOGQAM-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)