CAS 125620-13-5 is the registry number for 1-[4-(1H-tetraazol-1-yl)phenyl]ethanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
1-[4-(tetrazol-1-yl)phenyl]ethanone (CAS 125620-13-5) is a chemical compound with the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. IUPAC name: 1-[4-(tetrazol-1-yl)phenyl]ethanone. InChIKey: QRBRBXFYBWGBPP-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O |
|---|---|
| Molecular weight | 188.19 g/mol |
| IUPAC name | 1-[4-(tetrazol-1-yl)phenyl]ethanone |
| InChIKey | QRBRBXFYBWGBPP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C=NN=N2 |
Computed by PubChem (NCBI)