CAS 1256246-92-0 is the registry number for 3-Amino-6-hydroxy-2-methylquinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 5000mg, 2000mg.
3-amino-6-hydroxy-2-methylquinazolin-4-one (CAS 1256246-92-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 3-amino-6-hydroxy-2-methylquinazolin-4-one. InChIKey: WMHGSEBKCDYZBB-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-amino-6-hydroxy-2-methylquinazolin-4-one |
| InChIKey | WMHGSEBKCDYZBB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)O)C(=O)N1N |
Computed by PubChem (NCBI)