CAS 1256276-39-7 appears in our catalog under these names: 4-Bromo-2,5-difluorobenzylamine hydrochloride, 97%, (4-bromo-2,5-difluorophenyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
(4-bromo-2,5-difluorophenyl)methanamine;hydrochloride (CAS 1256276-39-7) is a chemical compound with the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)methanamine;hydrochloride. InChIKey: ABFWCVBXTWZQBC-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF2N |
|---|---|
| Molecular weight | 258.49 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | ABFWCVBXTWZQBC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)CN.Cl |
Computed by PubChem (NCBI)