CAS 2059988-69-9 appears in our catalog under these names: (4-Bromo-2,5-difluorophenyl)methanamine hydrochloride, 95%, (4-Bromo-2,5-difluorophenyl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
(4-bromo-2,5-difluorophenyl)methanamine;hydrochloride (CAS 2059988-69-9) is a chemical compound with the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)methanamine;hydrochloride. InChIKey: ABFWCVBXTWZQBC-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF2N |
|---|---|
| Molecular weight | 258.49 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | ABFWCVBXTWZQBC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)CN.Cl |
Computed by PubChem (NCBI)