CAS 1980086-47-2 appears in our catalog under these names: (4-Bromo-2,3-difluorophenyl)methanamine hydrochloride, 97%, (4–Bromo–2,3–difluorophenyl)methanamine hydrochloride, (4-bromo-2,3-difluorophenyl)methanamine hydrochloride, (4-Bromo-2,3-difluorophenyl)methanamine hydrochloride, 97%, 97%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 0,5g, 1g.
(4-bromo-2,3-difluorophenyl)methanamine;hydrochloride (CAS 1980086-47-2) is a chemical compound with the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. IUPAC name: (4-bromo-2,3-difluorophenyl)methanamine;hydrochloride. InChIKey: SLPDOYCVDFSKKB-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF2N |
|---|---|
| Molecular weight | 258.49 g/mol |
| IUPAC name | (4-bromo-2,3-difluorophenyl)methanamine;hydrochloride |
| InChIKey | SLPDOYCVDFSKKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN)F)F)Br.Cl |
Computed by PubChem (NCBI)